(R)-(+)-1-(4-Methylphenyl)ethylamine manufacturers
|
| | (R)-(+)-1-(4-Methylphenyl)ethylamine Basic information |
| | (R)-(+)-1-(4-Methylphenyl)ethylamine Chemical Properties |
| Melting point | <-20°C | | Boiling point | 205 °C (lit.) | | alpha | 37 º (NEAT) | | density | 0.919 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.521(lit.) | | Fp | 180 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | liquid | | pka | 9.20±0.10(Predicted) | | Specific Gravity | 0.919 | | optical activity | [α]20/D +37°, neat | | Sensitive | Air Sensitive | | BRN | 3195425 | | InChI | InChI=1/C9H13N/c1-7-3-5-9(6-4-7)8(2)10/h3-6,8H,10H2,1-2H3/t8-/s3 | | InChIKey | UZDDXUMOXKDXNE-SBYBRXNCNA-N | | SMILES | [C@@H](C1C=CC(C)=CC=1)(N)C |&1:0,r| | | CAS DataBase Reference | 4187-38-6(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 20/21/22-34 | | Safety Statements | 16-26-27-36/37/39-45 | | RIDADR | UN 2619 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2921490090 |
| | (R)-(+)-1-(4-Methylphenyl)ethylamine Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liquid | | Uses | (R)-(+)-α,4-Dimethylbenzylamine can be used as a chiral salt of keto acid, employed in the solid-state photolysis studies of α-mesitylacetophenone derivatives. | | Application | (R)-(+)-α,4-Dimethylbenzylamine reacts with
1,5-difluoro-2,4-dinitrobenzene (DFDNB) to form a chiral derivative
reagent(CDR) via substitution of one fluorine atom. | | General Description | (R)-(+)-α,4-Dimethylbenzylamine is a chiral amine. | | Synthesis | (R)-(+)-1-(4-methylphenyl)ethylamine was synthesized via a series of chemical reactions with (R)-N-[1-(4-methylphenyl)ethyl]acetamide. The steps are as follows:
1 g of the compound obtained in the previous stage will be used. 2 g of n-butanol was added, 0.63 g of potassium hydroxide was added, and the temperature was raised to 100 ° C. After 24 hours of heat preservation, cool down to 10 to 20 ℃. After adding water and stirring for 0.5 hours, the mixture was allowed to stand for separation, and the organic layer was concentrated to n-butanol, and then subjected to vacuum distillation (80-100 ℃ packed column) to obtain (R)-1-(4-methylphenyl)ethylamine 0.63 g. The yield was 82%, the HPLC purity was 96.3%, and the enantiomer was 0.8%.
 | | structure and hydrogen bonding | (R)-(+)-1-(4-Methylphenyl)ethylamine is a chiral molecule studied in the
context of crystallographic analysis and optimization. Through X-ray
diffraction analysis, the crystal structure of (R)-(+)-1-(4-Methylphenyl)ethylamine was determined, revealing the presence
of a significant hydrogen bond between the amine group and one of the
carbonyl groups. This hydrogen bond plays a crucial role in stabilizing
the (R)-(+)-1-(4-Methylphenyl)ethylamine molecule, which is a recurring
pattern observed in structurally similar compounds. Furthermore, the
(S)-(+)-enantiomer of (R)-(+)-1-(4-Methylphenyl)ethylamine was synthesized
using an enantiopure precursor, establishing an efficient method to
obtain this desired form of the molecule. |
| | (R)-(+)-1-(4-Methylphenyl)ethylamine Preparation Products And Raw materials |
|