|
|
| | Tert-Butyl trans-4-(2-oxoethyl)cyclohexylcarbamate Basic information | | Uses |
| Product Name: | Tert-Butyl trans-4-(2-oxoethyl)cyclohexylcarbamate | | Synonyms: | TERT-BUTYL TRANS-4-(2-OXOETHYL)CYCLOHEXYLCARBAMATE;N-[trans-4-(2-Oxoethyl)cyclohexyl]carbaMic Acid 1,1-DiMethylethyl Ester;[trans-4-(2-Oxoethyl)cyclohexyl]carbamic acid tert-butyl ester;2-[trans-4-[(tert-Butoxycarbonyl)amino]cyclohexyl]acetaldehyde;trans-2-[4-[(tert-Butyloxycarbonyl)amino]cyclohexyl]acetaldehyde;trans-Boc-2-(4-aminocyclohexyl)acetaldehyde;trans-4-(Boc-aMino)cyclohexaneacetaldehyde, 97%;tert-butyl trans-N-[4-(2-oxoethyl)cyclohexyl]carbamate | | CAS: | 215790-29-7 | | MF: | C13H23NO3 | | MW: | 241.33 | | EINECS: | | | Product Categories: | | | Mol File: | 215790-29-7.mol |  |
| | Tert-Butyl trans-4-(2-oxoethyl)cyclohexylcarbamate Chemical Properties |
| Boiling point | 360.6±11.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | solubility | Sparingly Soluble (0.41 g/L) (25°C). | | pka | 12.50±0.40(Predicted) | | InChI | InChI=1S/C13H23NO3/c1-13(2,3)17-12(16)14-11-6-4-10(5-7-11)8-9-15/h9-11H,4-8H2,1-3H3,(H,14,16)/t10-,11- | | InChIKey | OPGBSEXLSWYFOR-XYPYZODXSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CC[C@@H](CC=O)CC1 |
| | Tert-Butyl trans-4-(2-oxoethyl)cyclohexylcarbamate Usage And Synthesis |
| Uses | N-[trans-4-(2-Oxoethyl)cyclohexyl]carbamic Acid 1,1-Dimethylethyl Ester, is an intermediate for the synthesis of Cariprazine, a novel antipsychotic acting on dopamine D3/D2 receptors. | | Uses | N-[trans-4-(2-Oxoethyl)cyclohexyl]carbamic Acid 1,1-Dimethylethyl Ester, is an intermediate for the synthesis of Cariprazine (C183490), a novel antipsychotic acting on dopamine D3/D2 receptors. |
| | Tert-Butyl trans-4-(2-oxoethyl)cyclohexylcarbamate Preparation Products And Raw materials |
|