| Company Name: |
LANSPHARMA
|
| Tel: |
+91-9000766909 +91-9000766909 |
| Email: |
info@lanspharma.com |
| Products Intro: |
Product Name:(3R)-3-Amino-4-(2,5-difluorophenyl)-1-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3- a]pyrazin-7(8H)-yl]butan-1-one Phosphate Hydrate Salt
CAS:1345822-87-8
Purity:98% Package:1 g, 10 g, 50 g, 100 g, 1 Kg
|
|
| | Sitagliptin EP Impurity B Basic information |
| Product Name: | Sitagliptin EP Impurity B | | Synonyms: | Sitagliptin EP Impurity B;Sitagliptin impurity 3/Sitagliptin EP Impurity B/Sitagliptin 4-Desfluoro Impurity/(R)-4-Oxo-4-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-1-(2,5-difluorophenyl)butan-2-amine phosphate;4-Desfluoro Sitagliptin;(R)-4-Oxo-4-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-1-(2,5-difluorophenyl)butan-2-amine phosphate;4-Desfluoro Sitagliptin Phosphate;Sitagliptin EP Impurity B Phosphate;Sitagliptin EP Impurity B / Sitagliptin 4-Desfluoro Impurity;Sitagliptin?4-Desfluoro?Impurity | | CAS: | 1345822-87-8 | | MF: | C16H19F5N5O5P | | MW: | 487.318337 | | EINECS: | | | Product Categories: | | | Mol File: | 1345822-87-8.mol |  |
| | Sitagliptin EP Impurity B Chemical Properties |
| storage temp. | 2-8°C | | InChIKey | UOKMPNRCGWVMBY-XAAIUDFWNA-N | | SMILES | P(O)(O)(O)=O.C(N1CCN2C(C(F)(F)F)=NN=C2C1)(=O)C[C@H](N)CC1=CC(F)=CC=C1F |&1:21,r| |
| | Sitagliptin EP Impurity B Usage And Synthesis |
| Uses | 4-Desfluoro Sitagliptin is a metabolite of Sitagliptin phosphate (S491000). Sitagliptin is a trizolopyrazine dipeptidyl peptidase IV inhibitor. Sitagliptin has recently been approved for the therapy of type II diabetes. | | Uses | Sitagliptin EP Impurity B is an impurity of the synthetic drug Sitagliptin. It can be used as an impurity reference to detect the quality of drugs, and is often used in pharmaceutical synthesis. Sitagliptin is used with a proper diet and exercise program and possibly with other medications to control high blood sugar. It is used in people with type 2 diabetes. Sitagliptin is not for treating type 1 diabetes |
| | Sitagliptin EP Impurity B Preparation Products And Raw materials |
|