1,3-O-BENZYLIDENEGLYCEROL manufacturers
|
| | 1,3-O-BENZYLIDENEGLYCEROL Basic information |
| Product Name: | 1,3-O-BENZYLIDENEGLYCEROL | | Synonyms: | 2-phenyl-3-dioxan-5-ol;2-PHENYL-1,3-DIOXAN-2-OL;2-PHENYL-1,3-DIOXAN-5-OL;5-HYDROXY-2-PHENYL-1,3-DIOXANE;1,3-O-BENZYLIDENEGLYCEROL, MIXTURE OF CI S AND TRANS;purum,mixtureofcis-andtrans-isomeres;2-PHENYL-1,3-DIOXAN-5-OL PURUM MIXTURE OF CIS AND TRANS 97+%;2-PHENYL-1,3-DIOXAN-5-OL MIXTURE OF CIS AND TRANS 97+% | | CAS: | 1708-40-3 | | MF: | C10H12O3 | | MW: | 180.2 | | EINECS: | 216-963-7 | | Product Categories: | Dioxanes;Dioxanes & Dioxolanes | | Mol File: | 1708-40-3.mol |  |
| | 1,3-O-BENZYLIDENEGLYCEROL Chemical Properties |
| Melting point | 84 °C | | Boiling point | 165-170 °C(Press: 10 Torr) | | density | 1.203±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol,Acetone | | form | powder to crystal | | pka | 13.55±0.40(Predicted) | | color | White to Almost white | | BRN | 84059 | | InChI | InChI=1S/C10H12O3/c11-9-6-12-10(13-7-9)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2 | | InChIKey | BWKDAAFSXYPQOS-UHFFFAOYSA-N | | SMILES | O1CC(O)COC1C1=CC=CC=C1 | | EPA Substance Registry System | 1,3-Dioxan-5-ol, 2-phenyl- (1708-40-3) |
| Risk Statements | 22 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 1-10 | | HS Code | 2932.99.9090 |
| | 1,3-O-BENZYLIDENEGLYCEROL Usage And Synthesis |
| Uses | 2-Phenyl-1,3-dioxan-5-ol was used as starting reagent in the synthesis of carbonate of glycerol monomer, 5-benzyloxy-1,3-dioxan-2-one which forms copolymers with ε-caprolactone. | | Definition | ChEBI: Benzaldehyde glyceryl acetal is a member of dioxanes. | | General Description | cis-2-phenyl-1,3-dioxan-5-ol reacts with triphenylphosphine-carbon tetrabromide to yield cis-4-bromomethyl-2-phenyl-1,3-dioxolan, its trans-diastereoisomer and trans-5-bromo-2-phenyl-1,3-dioxan. |
| | 1,3-O-BENZYLIDENEGLYCEROL Preparation Products And Raw materials |
|