|
|
| | 6-Hydroxy-5-nitronicotinic acid Basic information |
| | 6-Hydroxy-5-nitronicotinic acid Chemical Properties |
| Melting point | 269-271 | | Boiling point | 363.6±42.0 °C(Predicted) | | density | 1.70±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 3.09±0.50(Predicted) | | color | Light yellow to Yellow | | BRN | 177986 | | InChI | InChI=1S/C6H4N2O5/c9-5-4(8(12)13)1-3(2-7-5)6(10)11/h1-2H,(H,7,9)(H,10,11) | | InChIKey | VJMXJGVEVASJOD-UHFFFAOYSA-N | | SMILES | C1NC(=O)C([N+]([O-])=O)=CC=1C(O)=O | | CAS DataBase Reference | 6635-31-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37 | | Safety Statements | 26 | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 6-Hydroxy-5-nitronicotinic acid Usage And Synthesis |
| Synthesis | 6-Hydroxy-5-nitronicotinic acid is synthesised using 6-Hydroxynicotinic acid as a raw material by chemical reaction. The specific synthesis steps are as follows:
6-Hydroxynicotinic acid 2 (25.0 g, 180 mmol) was dissolved in HNO3 fuming (1.52) (95 mL) and stirred at 50 oC for 18 h. After the solution was cooled to room temperature, the mixture was concentrated, and then co-evaporated with water, followed by the addition of MeOH to afford a brown precipitate. The precipitate was filtered and washed with 50 mL of cold MeOH twice. After drying under reduced pressure, a brown color product 3 was obtained; yield: 9.67 g (29percent); 1H NMR (300 MHz, CD3OD) 8.44 (d, J = 2.6 Hz, 1H), 8.85 (d, J = 2.6 Hz, 1H) ; HRMS (ES+): m/z 185.0194 (M+H+) (calcd for C6H5N2O5: 185.0198).
 |
| | 6-Hydroxy-5-nitronicotinic acid Preparation Products And Raw materials |
|