Tris(tetrabutylammonium) hydrogen pyrophosphate manufacturers
|
| | Tris(tetrabutylammonium) hydrogen pyrophosphate Basic information |
| Product Name: | Tris(tetrabutylammonium) hydrogen pyrophosphate | | Synonyms: | Tris(tetrabutylammonium) hydrogen pyrophosphate,Pyrophosphoric acid tris(tetrabutylammonium) salt, Tetrabutylammonium pyrophosphate (3:1);TETRABUTYLAMMONIUM PYROPHOSPHATE (3:1);TRIS(TETRABUTYLAMMONIUM) HYDROGEN PYROPHOSPHATE;Tris(tetrabutylaMMoniuM) hydrogen pyrophosphate >=97.0% (calc. on dry substance, T);Tris(tetrabutylammonium) pyrophosphate;Tris(tetra-N-butylammonium)diphosphate;Tris(tetra-n-butylamonium) hydrogen pyrophosphate;tris(tetrabutylazanium)?hydrogen?(phosphonooxy)phosphonate | | CAS: | 76947-02-9 | | MF: | C16H37NO7P2(-2) | | MW: | 417.42 | | EINECS: | | | Product Categories: | | | Mol File: | 76947-02-9.mol |  |
| | Tris(tetrabutylammonium) hydrogen pyrophosphate Chemical Properties |
| Melting point | 145 - 148°C | | storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Light Yellow | | BRN | 4632762 | | Stability: | Hygroscopic | | InChI | InChI=1S/C16H36N.H4O7P2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-8(2,3)7-9(4,5)6/h5-16H2,1-4H3;(H2,1,2,3)(H2,4,5,6)/q+1;/p-3 | | InChIKey | BMTUFQKYWWLCLC-UHFFFAOYSA-K | | SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.O(P(O)([O-])=O)P([O-])([O-])=O |
| | Tris(tetrabutylammonium) hydrogen pyrophosphate Usage And Synthesis |
| Description | Tris(tetrabutylammonium) hydrogen pyrophosphate is a reagent used for pyrophosphorylation, reactions involving isoprenoid derivatives, and the pyrophosphorylation and triphosphorylation of nucleosides.
Tris(tetrabutylammonium) hydrogen pyrophosphate. A new reagent for the preparation of allylic pyrophosphate esters | | Chemical Properties | White Crystalline Powder | | Uses | Phosphorylating reagent. | | Application | Tris(tetrabutylammonium) hydrogen pyrophosphate was used for:
Reagent for pyrophosphorylation
reaction of isoprenoid derivatives
Pyrophosphorylation of nucleosides
Triphosphorylation of nucleosides | | General Description | Tris(tetrabutylammonium) hydrogen pyrophosphate is a triphosphate that is used as a nucleophile in organic synthesis. It reacts with isopropyl alcohol to form the corresponding cyclic adducts, which can be isolated as the corresponding acetonitrile salts. Tris(tetrabutylammonium) hydrogen pyrophosphate is also used as an intermediate for the synthesis of other molecules, such as geranyl, and provides a predictable means of synthesizing isotopomers of these molecules. This molecule may be prepared by reacting ammonium bicarbonate with chloride and then adding isopropyl alcohol to the mixture. |
| | Tris(tetrabutylammonium) hydrogen pyrophosphate Preparation Products And Raw materials |
|