Company Name: |
Chemwill Asia Co.,Ltd.
|
Tel: |
86-21-51086038 |
Email: |
chemwill_asia@126.com |
Products Intro: |
CAS:62023-58-9 Purity:0.99 Package:5KG;1KG;25KG PRICE quotation Remarks:Factory stock, quality assurance, price concessions
|
|
| N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid Basic information |
Product Name: | N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid | Synonyms: | N-CBZ-(2R,3R)-3-AMINO-2-HYDROXY-4-PHENYL-BUTYRIC ACID;N-cbz-(2R,3R)-3-amino-2-hydroxy-4-*phenylbutyric;N-CBZ-(2R,3R)-3-AMINO-2-HYDROXY-4-PHENYL BUTYRIC AC;(2r,3r)-3-(z-amino)-2-hydroxy-4-phenylbutyric acid;BOC-D-CYS(4-CH3BZL)-OH;Z-(2R,3R)-AHPA,;N-CBZ-(2R,3R)-3-AMINO-2-HYDROXY-4-PHENYL;Benzenebutanoic acid, α-hydroxy-β-[[(phenylmethoxy)carbonyl]amino]-, (αR,βR)- | CAS: | 62023-58-9 | MF: | C18H19NO5 | MW: | 329.35 | EINECS: | | Product Categories: | | Mol File: | 62023-58-9.mol |  |
| N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid Chemical Properties |
Melting point | 172-174 °C | Boiling point | 581.9±50.0 °C(Predicted) | density | 1.295±0.06 g/cm3(Predicted) | storage temp. | −20°C | pka | 3.56±0.17(Predicted) | InChI | InChI=1/C18H19NO5/c20-16(17(21)22)15(11-13-7-3-1-4-8-13)19-18(23)24-12-14-9-5-2-6-10-14/h1-10,15-16,20H,11-12H2,(H,19,23)(H,21,22)/t15-,16-/s3 | InChIKey | JXJYTERRLRAUSF-DPLXLLBNNA-N | SMILES | [C@@H]([C@@H](O)C(=O)O)(NC(=O)OCC1C=CC=CC=1)CC1C=CC=CC=1 |&1:0,1,r| |
| N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid Usage And Synthesis |
Uses | N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid is a reactive reagent that can be used in the cyanidation of carbonyl compounds. |
| N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid Preparation Products And Raw materials |
|