- 1,1-diethoxynonane
-
- $0.00 / 200KG
-
2024-11-04
- CAS:54815-13-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- 1,1-diethoxynonane
-
- $0.00 / 25KG
-
2023-10-09
- CAS:54815-13-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
|
| | 1,1-diethoxynonane Basic information |
| Product Name: | 1,1-diethoxynonane | | Synonyms: | 1,1-diethoxynonane;Nonanaldiethylacetal;Nonane, 1,1-diethoxy-;pelargonaldehyde diethyl acetal;NonanalDiethylAcetal>;Nonyl Aldehyde Diethyl Acetal | | CAS: | 54815-13-3 | | MF: | C13H28O2 | | MW: | 216.36 | | EINECS: | 259-360-4 | | Product Categories: | | | Mol File: | 54815-13-3.mol |  |
| | 1,1-diethoxynonane Chemical Properties |
| Boiling point | 66°C/0.3mmHg(lit.) | | density | 0.844±0.06 g/cm3(Predicted) | | refractive index | 1.4190 to 1.4230 | | solubility | Practically insoluble in water, soluble in alcohol and oils. | | form | clear liquid | | color | Colorless to Almost colorless | | Odor | at 10.00 % in dipropylene glycol. aldehydic floral rose | | Odor Type | aldehydic | | InChI | InChI=1S/C13H28O2/c1-4-7-8-9-10-11-12-13(14-5-2)15-6-3/h13H,4-12H2,1-3H3 | | InChIKey | RJMSGTVQHHFVLK-UHFFFAOYSA-N | | SMILES | C(OCC)(OCC)CCCCCCCC | | LogP | 4.588 (est) | | NIST Chemistry Reference | Nonane, 1,1-diethoxy-(54815-13-3) | | EPA Substance Registry System | Nonane, 1,1-diethoxy- (54815-13-3) |
| | 1,1-diethoxynonane Usage And Synthesis |
| Preparation | By condensation of Nonanal with
Ethyl alcohol. |
| | 1,1-diethoxynonane Preparation Products And Raw materials |
|