|
|
| | Z-BETA-ALA-NH2 Basic information |
| Product Name: | Z-BETA-ALA-NH2 | | Synonyms: | Z-b-Ala-NH2;N-(3-amino-3-keto-propyl)carbamic acid benzyl ester;phenylmethyl N-(3-amino-3-oxopropyl)carbamate;phenylmethyl N-(3-azanyl-3-oxo-propyl)carbamate;benzyl 3-aMino-3-oxopropylcarbaMate;Cbz-beta-alanine amide;3-Z-aminopropionamide;Z-β-alanine amide≥ 99% (HPLC) | | CAS: | 886-64-6 | | MF: | C11H14N2O3 | | MW: | 222.24 | | EINECS: | | | Product Categories: | | | Mol File: | 886-64-6.mol |  |
| | Z-BETA-ALA-NH2 Chemical Properties |
| InChI | InChI=1S/C11H14N2O3/c12-10(14)6-7-13-11(15)16-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H2,12,14)(H,13,15) | | InChIKey | JSVDOBZAAAJMBU-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)NCCC(N)=O |
| | Z-BETA-ALA-NH2 Usage And Synthesis |
| Chemical Properties | White crystalline powder |
| | Z-BETA-ALA-NH2 Preparation Products And Raw materials |
|