|
|
| | Ethyl 4-hydroxypiperidine-1-carboxylate Basic information |
| Product Name: | Ethyl 4-hydroxypiperidine-1-carboxylate | | Synonyms: | 1-(Ethoxycarbonyl)piperidin-4-ol;N-Carboethoxypiperidine-4-Ol;N-carbethoxy-4-piperidinemethanol;N-carbethoxy-4-hydroxypiperidone.;Ethyl 4-hydroxypiperidine-1-caroxylate;Ethyl 4-hydroxy-N-piperidinecarboxylate;1-Ethoxycarbonyl-1-piperidinol, 98%;Ethyl 4-hydroxypiperidine-1-ca | | CAS: | 65214-82-6 | | MF: | C8H15NO3 | | MW: | 173.21 | | EINECS: | 265-636-5 | | Product Categories: | Piperidine | | Mol File: | 65214-82-6.mol |  |
| | Ethyl 4-hydroxypiperidine-1-carboxylate Chemical Properties |
| Boiling point | 120-130 °C(Press: 0.098 Torr) | | density | 1.12 | | refractive index | 1.4802 | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | pka | 14.80±0.20(Predicted) | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C8H15NO3/c1-2-12-8(11)9-5-3-7(10)4-6-9/h7,10H,2-6H2,1H3 | | InChIKey | QABJNOSERNVHDY-UHFFFAOYSA-N | | SMILES | N1(C(OCC)=O)CCC(O)CC1 | | CAS DataBase Reference | 65214-82-6(CAS DataBase Reference) |
| Safety Statements | 24/25 | | HS Code | 29333990 |
| | Ethyl 4-hydroxypiperidine-1-carboxylate Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Ethyl 4-hydroxypethidine-1-carboxylate is mainly used as a pharmaceutical intermediate and a raw material for organic matter. It can be used in the synthesis of antihistamines, antipsychotics, antidepressants, and various pesticides. As an intermediate, the compound can also produce fungicides and insecticides. It can be used as a raw material for synthetic surfactants, flavors, and fragrances. | | Preparation | Add triethylamine (1.5 equivalent) and ethyl chlorine 4-hydroxypiperidine-1-carboxylate (1.2 equivalent) to the dichloromethane solution of 4-hydroxypiperidine (1.0 equivalent) at 0 °C. Stir the mixture at 0 °C for 30 min. The reaction mixture is then poured into water and extracted with methylene chloride. Wash organic extracts with water and salt water. The compound is placed on sodium sulfate to dry. Finally, the organic extract is concentrated under reduced pressure to obtainEthyl 4-hydroxypiperidine-1-carboxylate. |
| | Ethyl 4-hydroxypiperidine-1-carboxylate Preparation Products And Raw materials |
|