|
|
| | 3-BROMO-5-CHLOROTOLUENE Basic information |
| Product Name: | 3-BROMO-5-CHLOROTOLUENE | | Synonyms: | 3-Bromo-5-chlorotoluene 98%;3-BROMO-5-CHLOROTOLUENE;1-BROMO-3-CHLORO-5-METHYLBENZENE;3-Chloro-5-methyl-bromobenzene;3-bromo-5-chlorotlouene;Benzene,1-bromo-3-chloro-5-methyl- | | CAS: | 329944-72-1 | | MF: | C7H6BrCl | | MW: | 205.48 | | EINECS: | | | Product Categories: | blocks;Bromides | | Mol File: | 329944-72-1.mol |  |
| | 3-BROMO-5-CHLOROTOLUENE Chemical Properties |
| Melting point | 25℃ | | Boiling point | 222.3±20.0℃ (760 Torr) | | density | 1.535±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 101.5±11.9℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Ethyl Acetate | | form | Solid | | color | Pale Yellow | | InChI | InChI=1S/C7H6BrCl/c1-5-2-6(8)4-7(9)3-5/h2-4H,1H3 | | InChIKey | YRIKDGJWRMHTJP-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(C)=CC(Cl)=C1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | Hazard Note | Irritant | | HS Code | 2903998090 |
| | 3-BROMO-5-CHLOROTOLUENE Usage And Synthesis |
| Uses | 3-Bromo-5-chlorotoluene is a reagent used in the synthesis of novel benzophenones towards the discovery of potent, next generation HIV nonnucleoside reverse transcriptase inhibitors. |
| | 3-BROMO-5-CHLOROTOLUENE Preparation Products And Raw materials |
|