|
| 3-BROMO-5-CHLOROTOLUENE Basic information |
Product Name: | 3-BROMO-5-CHLOROTOLUENE | Synonyms: | 3-Bromo-5-chlorotoluene 98%;3-BROMO-5-CHLOROTOLUENE;1-BROMO-3-CHLORO-5-METHYLBENZENE;3-Chloro-5-methyl-bromobenzene;3-bromo-5-chlorotlouene;Benzene,1-bromo-3-chloro-5-methyl- | CAS: | 329944-72-1 | MF: | C7H6BrCl | MW: | 205.48 | EINECS: | | Product Categories: | blocks;Bromides | Mol File: | 329944-72-1.mol |  |
| 3-BROMO-5-CHLOROTOLUENE Chemical Properties |
Melting point | 25℃ | Boiling point | 222.3±20.0℃ (760 Torr) | density | 1.535±0.06 g/cm3 (20 ºC 760 Torr) | Fp | 101.5±11.9℃ | storage temp. | Sealed in dry,Room Temperature | solubility | Chloroform, Ethyl Acetate | form | Solid | color | Pale Yellow | InChI | InChI=1S/C7H6BrCl/c1-5-2-6(8)4-7(9)3-5/h2-4H,1H3 | InChIKey | YRIKDGJWRMHTJP-UHFFFAOYSA-N | SMILES | C1(Br)=CC(C)=CC(Cl)=C1 |
Hazard Codes | Xi,Xn | Risk Statements | 22 | Hazard Note | Irritant | HS Code | 2903998090 |
| 3-BROMO-5-CHLOROTOLUENE Usage And Synthesis |
Uses | 3-Bromo-5-chlorotoluene is a reagent used in the synthesis of novel benzophenones towards the discovery of potent, next generation HIV nonnucleoside reverse transcriptase inhibitors. |
| 3-BROMO-5-CHLOROTOLUENE Preparation Products And Raw materials |
|