|
| 1-(4-Aminophenyl)-4-(4-hydroxyphenyl)piperazine Basic information |
| 1-(4-Aminophenyl)-4-(4-hydroxyphenyl)piperazine Chemical Properties |
Boiling point | 532.8±50.0 °C(Predicted) | density | 1.237±0.06 g/cm3(Predicted) | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) | form | Solid:crystalline | pka | 12.18±0.30(Predicted) | InChI | InChI=1S/C16H19N3O/c17-13-1-3-14(4-2-13)18-9-11-19(12-10-18)15-5-7-16(20)8-6-15/h1-8,20H,9-12,17H2 | InChIKey | WZIJMPVPOMTRNM-UHFFFAOYSA-N | SMILES | C1(O)=CC=C(N2CCN(C3=CC=C(N)C=C3)CC2)C=C1 | CAS DataBase Reference | 74853-08-0(CAS DataBase Reference) |
| 1-(4-Aminophenyl)-4-(4-hydroxyphenyl)piperazine Usage And Synthesis |
Uses | 4-[4-(4-Aminophenyl)-1-piperazinyl]phendiamineol is an intermediate of Posaconazole (P689600), which is orally active antifungal triazole. |
| 1-(4-Aminophenyl)-4-(4-hydroxyphenyl)piperazine Preparation Products And Raw materials |
|