dioctyl terephthalate manufacturers
- dioctyl terephthalate
-
- $1.00 / 1KG
-
2024-07-31
- CAS:4654-26-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100000KG
- dioctyl terephthalate
-
- $1.00 / 1KG
-
2020-01-15
- CAS:4654-26-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg ,5kg, 50kg
|
| | dioctyl terephthalate Basic information |
| Product Name: | dioctyl terephthalate | | Synonyms: | DI-N-OCTYLTEREPHTHALATE;Terephthalic acid dioctyl ester;1,4-Benzenedicarboxylic acid, dioctyl ester;1,4-Benzenedicarboxylic acid, 1,4-dioctyl ester | | CAS: | 4654-26-6 | | MF: | C24H38O4 | | MW: | 390.56 | | EINECS: | 225-091-6 | | Product Categories: | | | Mol File: | 4654-26-6.mol |  |
| | dioctyl terephthalate Chemical Properties |
| Melting point | 41-42 °C | | Boiling point | 435.74°C (rough estimate) | | density | 1.0101 (rough estimate) | | refractive index | 1.4460 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C24H38O4/c1-3-5-7-9-11-13-19-27-23(25)21-15-17-22(18-16-21)24(26)28-20-14-12-10-8-6-4-2/h15-18H,3-14,19-20H2,1-2H3 | | InChIKey | OEIWPNWSDYFMIL-UHFFFAOYSA-N | | SMILES | C1(C(OCCCCCCCC)=O)=CC=C(C(OCCCCCCCC)=O)C=C1 | | EPA Substance Registry System | Dioctyl terephthalate (4654-26-6) |
| | dioctyl terephthalate Usage And Synthesis |
| | dioctyl terephthalate Preparation Products And Raw materials |
|