Identification | Back Directory | [Name]
Phosphine, dicyclohexyl[3-(1-methylethoxy)-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]- | [CAS]
2118959-55-8 | [Synonyms]
Dicyclohexyl(3-isopropoxy-2’,4’,6’-triisopropyl-2-biphenylyl)phosphine Dicyclohexyl(3-isopropoxy-2',4',6'-triisopropyl-[1,1'-biphenyl]-2-yl)phosphine Dicyclohexyl-[2-propan-2-yloxy-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane Dicyclohexyl(3-isopropoxy-2',4',6'-triisopropyl-[1,1'-biphenyl]-2-YL)phosphine
(ephos) Dicyclohexyl[3-(1-methylethoxy)-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine Phosphine, dicyclohexyl[3-(1-methylethoxy)-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]- | [Molecular Formula]
C36H55OP | [MOL File]
2118959-55-8.mol | [Molecular Weight]
534.8 |
Chemical Properties | Back Directory | [Melting point ]
161-162 °C | [Boiling point ]
612.7±55.0 °C(Predicted) | [form ]
powder or crystals | [InChIKey]
FDAKNRLXSJBEFL-UHFFFAOYSA-N | [SMILES]
P(C1CCCCC1)(C1CCCCC1)C1=C(OC(C)C)C=CC=C1C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C |
Hazard Information | Back Directory | [Uses]
Ephos can be used as a ligand in the palladium-catalyzed synthesis of 4-arylaminothiazoles and 2-arylaminooxazoles. | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst reaction type: Cross Couplings reagent type: ligand |
|
Company Name: |
Jia Xing Isenchem Co.,Ltd
|
Tel: |
0573-85285100 18627885956 |
Website: |
http://www.yuhua99.com/ShowSupplierProductsList14265/0.htm |
|